摘要
Transition metal coordinated porphyins generally exhibit effective carbon-chloride bond cleavage of environmentally harmful organochlorides through electrochemical reductive catalysis in non-aquaous media, but the recyclable use of the catalyst remains a challenge. In this manuscirpt, a new strategy of an efficient and recyclable C-Cl bond cleavage is described, and the structural characterization, electrochemical behaviour and electrochemical catalysis were illustrated by various techniques. It is demonstrated that the Fe3O4@SiO2@Co(II)porphyrin magnetic materials can be effectively used for at least 30 cycles.